C12H11Cl2F3N4O2 — CID 78292335
6-chloro-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4-dione (PubChem CID 78292335) has the molecular formula C12H11Cl2F3N4O2 and a molecular weight of 371.15 g/mol. Its IUPAC name is 6-chloro-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4-dione.
| Compound Name | 6-chloro-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78292335 |
| Molecular Formula | C12H11Cl2F3N4O2 |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 6-chloro-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CC(Cl)NC(=O)N1CCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H11Cl2F3N4O2/c13-7-3-6(12(15,16)17)5-19-10(7)18-1-2-21-9(22)4-8(14)20-11(21)23/h3,5,8H,1-2,4H2,(H,18,19)(H,20,23) |
| InChIKey | DTOLYNJBFRRPKT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|