C14H13ClF3N5O4 — CID 7085804
(5R)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(methoxyiminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7085804) has the molecular formula C14H13ClF3N5O4 and a molecular weight of 407.74 g/mol. Its IUPAC name is (5R)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(methoxyiminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(methoxyiminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7085804 |
| Molecular Formula | C14H13ClF3N5O4 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (5R)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(methoxyiminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CON=C[C@@H]1C(=O)NC(=O)N(CCNc2ncc(C(F)(F)F)cc2Cl)C1=O |
| InChI | InChI=1S/C14H13ClF3N5O4/c1-27-21-6-8-11(24)22-13(26)23(12(8)25)3-2-19-10-9(15)4-7(5-20-10)14(16,17)18/h4-6,8H,2-3H2,1H3,(H,19,20)(H,22,24,26)/t8-/m1/s1 |
| InChIKey | CGZLQFKQGSZWHI-MRVPVSSYSA-N |
| XLogP | 1.49 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|