C16H17ClF3N5O3 — CID 1486831
1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-[1-(dimethylamino)ethylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1486831) has the molecular formula C16H17ClF3N5O3 and a molecular weight of 419.79 g/mol. Its IUPAC name is 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-[1-(dimethylamino)ethylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-[1-(dimethylamino)ethylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1486831 |
| Molecular Formula | C16H17ClF3N5O3 |
| Molecular Weight | 419.79 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-[1-(dimethylamino)ethylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=C1C(=O)NC(=O)N(CCNc2ncc(C(F)(F)F)cc2Cl)C1=O)N(C)C |
| InChI | InChI=1S/C16H17ClF3N5O3/c1-8(24(2)3)11-13(26)23-15(28)25(14(11)27)5-4-21-12-10(17)6-9(7-22-12)16(18,19)20/h6-7H,4-5H2,1-3H3,(H,21,22)(H,23,26,28) |
| InChIKey | DBNJKEQMPRYWHL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|