C12H13ClF3N3O3 — CID 119346564
2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoyl-methylamino]acetic acid (PubChem CID 119346564) has the molecular formula C12H13ClF3N3O3 and a molecular weight of 339.70 g/mol. Its IUPAC name is 2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoyl-methylamino]acetic acid.
| Compound Name | 2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 119346564 |
| Molecular Formula | C12H13ClF3N3O3 |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)CCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H13ClF3N3O3/c1-19(6-10(21)22)9(20)2-3-17-11-8(13)4-7(5-18-11)12(14,15)16/h4-5H,2-3,6H2,1H3,(H,17,18)(H,21,22) |
| InChIKey | CXGNGWLFUPDNLG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |