C11H12ClF3N2O2 — CID 64701177
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-methylbutanoic acid (PubChem CID 64701177) has the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.68 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-methylbutanoic acid.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 64701177 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O2/c1-10(2,4-8(18)19)17-9-7(12)3-6(5-16-9)11(13,14)15/h3,5H,4H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | DYECIIBOTGGYLH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |