C8H6ClF3N2O3 — CID 115572196
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]oxyacetic acid (PubChem CID 115572196) has the molecular formula C8H6ClF3N2O3 and a molecular weight of 270.59 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]oxyacetic acid.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 115572196 |
| Molecular Formula | C8H6ClF3N2O3 |
| Molecular Weight | 270.59 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]oxyacetic acid |
| SMILES | O=C(O)CONc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H6ClF3N2O3/c9-5-1-4(8(10,11)12)2-13-7(5)14-17-3-6(15)16/h1-2H,3H2,(H,13,14)(H,15,16) |
| InChIKey | FOZOWGGEULGVEV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|