C12H12ClF3N2O3 — CID 2404388
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-methylpropanoate (PubChem CID 2404388) has the molecular formula C12H12ClF3N2O3 and a molecular weight of 324.69 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-methylpropanoate.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 2404388 |
| Molecular Formula | C12H12ClF3N2O3 |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC(=O)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H12ClF3N2O3/c1-6(2)11(20)21-5-9(19)18-10-8(13)3-7(4-17-10)12(14,15)16/h3-4,6H,5H2,1-2H3,(H,17,18,19) |
| InChIKey | VHVNWLUOKQPBEK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |