C20H15ClF3N3O5 — CID 46816512
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46816512) has the molecular formula C20H15ClF3N3O5 and a molecular weight of 469.80 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46816512 |
| Molecular Formula | C20H15ClF3N3O5 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(C(C)C(=O)OCC(=O)Nc1ncc(C(F)(F)F)cc1Cl)C2=O |
| InChI | InChI=1S/C20H15ClF3N3O5/c1-9-3-4-12-13(5-9)18(30)27(17(12)29)10(2)19(31)32-8-15(28)26-16-14(21)6-11(7-25-16)20(22,23)24/h3-7,10H,8H2,1-2H3,(H,25,26,28) |
| InChIKey | MPZYQMLIZYTTBP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|