C14H9ClF3N3O3 — CID 2376998
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 2376998) has the molecular formula C14H9ClF3N3O3 and a molecular weight of 359.69 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 2376998 |
| Molecular Formula | C14H9ClF3N3O3 |
| Molecular Weight | 359.69 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccccn1)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H9ClF3N3O3/c15-9-5-8(14(16,17)18)6-20-12(9)21-11(22)7-24-13(23)10-3-1-2-4-19-10/h1-6H,7H2,(H,20,21,22) |
| InChIKey | KVLUAUKHTGVXRK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.69 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |