C13H15ClF3N3O3 — CID 119347900
3-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoylamino]butanoic acid (PubChem CID 119347900) has the molecular formula C13H15ClF3N3O3 and a molecular weight of 353.73 g/mol. Its IUPAC name is 3-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoylamino]butanoic acid.
| Compound Name | 3-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119347900 |
| Molecular Formula | C13H15ClF3N3O3 |
| Molecular Weight | 353.73 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanoylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H15ClF3N3O3/c1-7(4-11(22)23)20-10(21)2-3-18-12-9(14)5-8(6-19-12)13(15,16)17/h5-7H,2-4H2,1H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | KVUFVUCWYGWUAV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |