C12H14ClF3N2O2 — CID 65224425
2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentanoic acid (PubChem CID 65224425) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is 2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentanoic acid.
| Compound Name | 2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 65224425 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]pentanoic acid |
| SMILES | CCCC(CNc1ncc(C(F)(F)F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14ClF3N2O2/c1-2-3-7(11(19)20)5-17-10-9(13)4-8(6-18-10)12(14,15)16/h4,6-7H,2-3,5H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | OUDJNQYDXSPNBO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |