C14H18ClF3N2 — CID 106012866
3-chloro-N-(3-cyclopentylpropyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 106012866) has the molecular formula C14H18ClF3N2 and a molecular weight of 306.76 g/mol. Its IUPAC name is 3-chloro-N-(3-cyclopentylpropyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(3-cyclopentylpropyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106012866 |
| Molecular Formula | C14H18ClF3N2 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-chloro-N-(3-cyclopentylpropyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(NCCCC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClF3N2/c15-12-8-11(14(16,17)18)9-20-13(12)19-7-3-6-10-4-1-2-5-10/h8-10H,1-7H2,(H,19,20) |
| InChIKey | KOUPNQPXEGFTNQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|