C13H18ClF3N2O — CID 115569610
N-(3-butoxypropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 115569610) has the molecular formula C13H18ClF3N2O and a molecular weight of 310.75 g/mol. Its IUPAC name is N-(3-butoxypropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3-butoxypropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115569610 |
| Molecular Formula | C13H18ClF3N2O |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-(3-butoxypropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCCOCCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H18ClF3N2O/c1-2-3-6-20-7-4-5-18-12-11(14)8-10(9-19-12)13(15,16)17/h8-9H,2-7H2,1H3,(H,18,19) |
| InChIKey | ZFHBCTLZHZIPLR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|