C11H13Cl2F3N2 — CID 107320716
3-chloro-N-(5-chloropentyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 107320716) has the molecular formula C11H13Cl2F3N2 and a molecular weight of 301.14 g/mol. Its IUPAC name is 3-chloro-N-(5-chloropentyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(5-chloropentyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107320716 |
| Molecular Formula | C11H13Cl2F3N2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-chloro-N-(5-chloropentyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(NCCCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2F3N2/c12-4-2-1-3-5-17-10-9(13)6-8(7-18-10)11(14,15)16/h6-7H,1-5H2,(H,17,18) |
| InChIKey | NXCKDVIAMUCEBR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|