C17H15ClF3N3O2 — CID 133330617
4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one (PubChem CID 133330617) has the molecular formula C17H15ClF3N3O2 and a molecular weight of 385.77 g/mol. Its IUPAC name is 4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133330617 |
| Molecular Formula | C17H15ClF3N3O2 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1CCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H15ClF3N3O2/c18-12-8-11(17(19,20)21)9-23-16(12)22-6-3-7-24-13-4-1-2-5-14(13)26-10-15(24)25/h1-2,4-5,8-9H,3,6-7,10H2,(H,22,23) |
| InChIKey | VVNUAFYKBVAHCW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|