C22H26N4O3 — CID 133330580
4-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one (PubChem CID 133330580) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133330580 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]amino]propyl]-1,4-benzoxazin-3-one |
| SMILES | O=C(c1cccnc1NCCCN1C(=O)COc2ccccc21)N1CCCCC1 |
| InChI | InChI=1S/C22H26N4O3/c27-20-16-29-19-10-3-2-9-18(19)26(20)15-7-12-24-21-17(8-6-11-23-21)22(28)25-13-4-1-5-14-25/h2-3,6,8-11H,1,4-5,7,12-16H2,(H,23,24) |
| InChIKey | UBIVHUVBWVFBBE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|