C17H18N4O3 — CID 133454985
4-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]pyridine-3-carboxamide (PubChem CID 133454985) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]pyridine-3-carboxamide.
| Compound Name | 4-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133454985 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-[3-(3-oxo-1,4-benzoxazin-4-yl)propylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1NCCCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C17H18N4O3/c18-17(23)12-10-19-8-6-13(12)20-7-3-9-21-14-4-1-2-5-15(14)24-11-16(21)22/h1-2,4-6,8,10H,3,7,9,11H2,(H2,18,23)(H,19,20) |
| InChIKey | OMBZBUURVWIZQM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|