C18H20N4O2 — CID 133330721
4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]propyl]-1,4-benzoxazin-3-one (PubChem CID 133330721) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133330721 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]propyl]-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1CCCNc1ccnc(C2CC2)n1 |
| InChI | InChI=1S/C18H20N4O2/c23-17-12-24-15-5-2-1-4-14(15)22(17)11-3-9-19-16-8-10-20-18(21-16)13-6-7-13/h1-2,4-5,8,10,13H,3,6-7,9,11-12H2,(H,19,20,21) |
| InChIKey | FYHGMNCNJUPINR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|