C21H27N5O2 — CID 133330739
4-[3-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]propyl]-1,4-benzoxazin-3-one (PubChem CID 133330739) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[3-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133330739 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-[3-[[6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]propyl]-1,4-benzoxazin-3-one |
| SMILES | CC1CCCN(c2cc(NCCCN3C(=O)COc4ccccc43)ncn2)C1 |
| InChI | InChI=1S/C21H27N5O2/c1-16-6-4-10-25(13-16)20-12-19(23-15-24-20)22-9-5-11-26-17-7-2-3-8-18(17)28-14-21(26)27/h2-3,7-8,12,15-16H,4-6,9-11,13-14H2,1H3,(H,22,23,24) |
| InChIKey | UOOCLAZSJWAVOQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|