C22H20N6O2 — CID 133330686
4-[3-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-benzoxazin-3-one (PubChem CID 133330686) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[3-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133330686 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[3-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1CCCNc1ccc2nnc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C22H20N6O2/c29-21-15-30-18-10-5-4-9-17(18)27(21)14-6-13-23-19-11-12-20-24-25-22(28(20)26-19)16-7-2-1-3-8-16/h1-5,7-12H,6,13-15H2,(H,23,26) |
| InChIKey | AGLZCMDRXLVZBK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|