C15H17N5S — CID 133304991
N-(3-methylsulfanylpropyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133304991) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(3-methylsulfanylpropyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133304991 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CSCCCNc1ccc2nnc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C15H17N5S/c1-21-11-5-10-16-13-8-9-14-17-18-15(20(14)19-13)12-6-3-2-4-7-12/h2-4,6-9H,5,10-11H2,1H3,(H,16,19) |
| InChIKey | DZRBVBBPRKATRH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|