C16H15FN8 — CID 167974477
3-(4-fluorophenyl)-N-[3-(1,2,4-triazol-4-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 167974477) has the molecular formula C16H15FN8 and a molecular weight of 338.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[3-(1,2,4-triazol-4-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(4-fluorophenyl)-N-[3-(1,2,4-triazol-4-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 167974477 |
| Molecular Formula | C16H15FN8 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[3-(1,2,4-triazol-4-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Fc1ccc(-c2nnc3ccc(NCCCn4cnnc4)nn23)cc1 |
| InChI | InChI=1S/C16H15FN8/c17-13-4-2-12(3-5-13)16-22-21-15-7-6-14(23-25(15)16)18-8-1-9-24-10-19-20-11-24/h2-7,10-11H,1,8-9H2,(H,18,23) |
| InChIKey | PUNCYKIMJYPTNK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|