C20H23N9S — CID 133489216
N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133489216) has the molecular formula C20H23N9S and a molecular weight of 421.53 g/mol. Its IUPAC name is N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133489216 |
| Molecular Formula | C20H23N9S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | c1cnc(N2CCN(CCCNc3ccc4nnc(-c5ccsc5)n4n3)CC2)nc1 |
| InChI | InChI=1S/C20H23N9S/c1-6-22-20(23-7-1)28-12-10-27(11-13-28)9-2-8-21-17-3-4-18-24-25-19(29(18)26-17)16-5-14-30-15-16/h1,3-7,14-15H,2,8-13H2,(H,21,26) |
| InChIKey | WEIVCWOHSVMPRU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|