C14H18N8 — CID 133325363
3-cyclopropyl-N-[4-(1,2,4-triazol-4-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133325363) has the molecular formula C14H18N8 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-cyclopropyl-N-[4-(1,2,4-triazol-4-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-cyclopropyl-N-[4-(1,2,4-triazol-4-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133325363 |
| Molecular Formula | C14H18N8 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-cyclopropyl-N-[4-(1,2,4-triazol-4-yl)butyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | c1cc2nnc(C3CC3)n2nc1NCCCCn1cnnc1 |
| InChI | InChI=1S/C14H18N8/c1(2-8-21-9-16-17-10-21)7-15-12-5-6-13-18-19-14(11-3-4-11)22(13)20-12/h5-6,9-11H,1-4,7-8H2,(H,15,20) |
| InChIKey | PGNCXIKLESGQIL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|