C18H23FN6O3S — CID 43957938
N-[2-[6-(3-ethoxypropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzenesulfonamide (PubChem CID 43957938) has the molecular formula C18H23FN6O3S and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[2-[6-(3-ethoxypropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-[6-(3-ethoxypropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43957938 |
| Molecular Formula | C18H23FN6O3S |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[2-[6-(3-ethoxypropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzenesulfonamide |
| SMILES | CCOCCCNc1ccc2nnc(CCNS(=O)(=O)c3ccc(F)cc3)n2n1 |
| InChI | InChI=1S/C18H23FN6O3S/c1-2-28-13-3-11-20-16-8-9-17-22-23-18(25(17)24-16)10-12-21-29(26,27)15-6-4-14(19)5-7-15/h4-9,21H,2-3,10-13H2,1H3,(H,20,24) |
| InChIKey | TWAZYSXKDZBPAN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|