C20H29N7O2S — CID 43958096
N-[2-[6-[3-(diethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide (PubChem CID 43958096) has the molecular formula C20H29N7O2S and a molecular weight of 431.57 g/mol. Its IUPAC name is N-[2-[6-[3-(diethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[6-[3-(diethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43958096 |
| Molecular Formula | C20H29N7O2S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[2-[6-[3-(diethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide |
| SMILES | CCN(CC)CCCNc1ccc2nnc(CCNS(=O)(=O)c3ccccc3)n2n1 |
| InChI | InChI=1S/C20H29N7O2S/c1-3-26(4-2)16-8-14-21-18-11-12-19-23-24-20(27(19)25-18)13-15-22-30(28,29)17-9-6-5-7-10-17/h5-7,9-12,22H,3-4,8,13-16H2,1-2H3,(H,21,25) |
| InChIKey | XGSKXJZRTSTXNC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|