C22H23FN6O2S — CID 43957910
4-fluoro-N-[2-[6-(3-phenylpropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide (PubChem CID 43957910) has the molecular formula C22H23FN6O2S and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-fluoro-N-[2-[6-(3-phenylpropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[6-(3-phenylpropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43957910 |
| Molecular Formula | C22H23FN6O2S |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-fluoro-N-[2-[6-(3-phenylpropylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1nnc2ccc(NCCCc3ccccc3)nn12)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN6O2S/c23-18-8-10-19(11-9-18)32(30,31)25-16-14-22-27-26-21-13-12-20(28-29(21)22)24-15-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-13,25H,4,7,14-16H2,(H,24,28) |
| InChIKey | FSQZZBBDAGMMCC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|