C20H24N6O2 — CID 86815345
tert-butyl N-[(E)-4-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]but-2-enyl]carbamate (PubChem CID 86815345) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 86815345 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | tert-butyl N-[(E)-4-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/CNc1ccc2nnc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C20H24N6O2/c1-20(2,3)28-19(27)22-14-8-7-13-21-16-11-12-17-23-24-18(26(17)25-16)15-9-5-4-6-10-15/h4-12H,13-14H2,1-3H3,(H,21,25)(H,22,27)/b8-7+ |
| InChIKey | SIGYRPGJXKNPTK-BQYQJAHWSA-N |
| XLogP | 3.28 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|