C18H20N2O4S — CID 133330727
4-[3-(2-methylsulfonylanilino)propyl]-1,4-benzoxazin-3-one (PubChem CID 133330727) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-[3-(2-methylsulfonylanilino)propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-(2-methylsulfonylanilino)propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133330727 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[3-(2-methylsulfonylanilino)propyl]-1,4-benzoxazin-3-one |
| SMILES | CS(=O)(=O)c1ccccc1NCCCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C18H20N2O4S/c1-25(22,23)17-10-5-2-7-14(17)19-11-6-12-20-15-8-3-4-9-16(15)24-13-18(20)21/h2-5,7-10,19H,6,11-13H2,1H3 |
| InChIKey | KYHADXFYIBWPIC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|