C19H20N6O2 — CID 133330600
4-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]propyl]-1,4-benzoxazin-3-one (PubChem CID 133330600) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133330600 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]propyl]-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(-n2nnnc2NCCCN2C(=O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N6O2/c1-14-7-9-15(10-8-14)25-19(21-22-23-25)20-11-4-12-24-16-5-2-3-6-17(16)27-13-18(24)26/h2-3,5-10H,4,11-13H2,1H3,(H,20,21,23) |
| InChIKey | GZXIVKVMEDBNRJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|