C13H11ClF3N3O2S — CID 31980902
3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzenesulfonamide (PubChem CID 31980902) has the molecular formula C13H11ClF3N3O2S and a molecular weight of 365.76 g/mol. Its IUPAC name is 3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzenesulfonamide.
| Compound Name | 3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31980902 |
| Molecular Formula | C13H11ClF3N3O2S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CNc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C13H11ClF3N3O2S/c14-11-5-9(13(15,16)17)7-20-12(11)19-6-8-2-1-3-10(4-8)23(18,21)22/h1-5,7H,6H2,(H,19,20)(H2,18,21,22) |
| InChIKey | QEEDFNVZWBWTGU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |