C17H17ClF3N3O3S — CID 27888872
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 27888872) has the molecular formula C17H17ClF3N3O3S and a molecular weight of 435.86 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 27888872 |
| Molecular Formula | C17H17ClF3N3O3S |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)NCCNc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C17H17ClF3N3O3S/c1-28(26,27)10-11-3-2-4-12(7-11)16(25)23-6-5-22-15-14(18)8-13(9-24-15)17(19,20)21/h2-4,7-9H,5-6,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | CFBQWUVYSJUMRU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|