C20H20ClF3N4O3 — CID 46593147
N-[3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylcarbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 46593147) has the molecular formula C20H20ClF3N4O3 and a molecular weight of 456.85 g/mol. Its IUPAC name is N-[3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylcarbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylcarbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 46593147 |
| Molecular Formula | C20H20ClF3N4O3 |
| Molecular Weight | 456.85 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-[3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylcarbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCNc1ncc(C(F)(F)F)cc1Cl)c1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C20H20ClF3N4O3/c21-15-10-13(20(22,23)24)11-27-17(15)25-6-7-26-18(29)12-3-1-4-14(9-12)28-19(30)16-5-2-8-31-16/h1,3-4,9-11,16H,2,5-8H2,(H,25,27)(H,26,29)(H,28,30) |
| InChIKey | RKDJCDIAGSXZGN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|