C17H17ClF3N5O2 — CID 142503793
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(propanoylamino)pyridine-4-carboxamide (PubChem CID 142503793) has the molecular formula C17H17ClF3N5O2 and a molecular weight of 415.80 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(propanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(propanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142503793 |
| Molecular Formula | C17H17ClF3N5O2 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(propanoylamino)pyridine-4-carboxamide |
| SMILES | CCC(=O)Nc1cc(C(=O)NCCNc2ncc(C(F)(F)F)cc2Cl)ccn1 |
| InChI | InChI=1S/C17H17ClF3N5O2/c1-2-14(27)26-13-7-10(3-4-22-13)16(28)24-6-5-23-15-12(18)8-11(9-25-15)17(19,20)21/h3-4,7-9H,2,5-6H2,1H3,(H,23,25)(H,24,28)(H,22,26,27) |
| InChIKey | WFICHYGNGPZBIY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|