C12H8BrClF3NS — CID 63487816
N-[(3-bromothiophen-2-yl)methyl]-2-chloro-6-(trifluoromethyl)aniline (PubChem CID 63487816) has the molecular formula C12H8BrClF3NS and a molecular weight of 370.62 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2-chloro-6-(trifluoromethyl)aniline.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2-chloro-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 63487816 |
| Molecular Formula | C12H8BrClF3NS |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2-chloro-6-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cccc(Cl)c1NCc1sccc1Br |
| InChI | InChI=1S/C12H8BrClF3NS/c13-8-4-5-19-10(8)6-18-11-7(12(15,16)17)2-1-3-9(11)14/h1-5,18H,6H2 |
| InChIKey | AJOYCJORZCIIDP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |