C12H11BrClN3OS — CID 114440359
5-[(3-bromothiophen-2-yl)methylamino]-4-chloro-2-prop-2-enylpyridazin-3-one (PubChem CID 114440359) has the molecular formula C12H11BrClN3OS and a molecular weight of 360.66 g/mol. Its IUPAC name is 5-[(3-bromothiophen-2-yl)methylamino]-4-chloro-2-prop-2-enylpyridazin-3-one.
| Compound Name | 5-[(3-bromothiophen-2-yl)methylamino]-4-chloro-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114440359 |
| Molecular Formula | C12H11BrClN3OS |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 5-[(3-bromothiophen-2-yl)methylamino]-4-chloro-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCc2sccc2Br)c(Cl)c1=O |
| InChI | InChI=1S/C12H11BrClN3OS/c1-2-4-17-12(18)11(14)9(6-16-17)15-7-10-8(13)3-5-19-10/h2-3,5-6,15H,1,4,7H2 |
| InChIKey | GTZOAYHDYTYIJV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|