C13H15BrClN3OS — CID 114440350
5-[(3-bromothiophen-2-yl)methylamino]-2-butyl-4-chloropyridazin-3-one (PubChem CID 114440350) has the molecular formula C13H15BrClN3OS and a molecular weight of 376.71 g/mol. Its IUPAC name is 5-[(3-bromothiophen-2-yl)methylamino]-2-butyl-4-chloropyridazin-3-one.
| Compound Name | 5-[(3-bromothiophen-2-yl)methylamino]-2-butyl-4-chloropyridazin-3-one |
|---|---|
| PubChem CID | 114440350 |
| Molecular Formula | C13H15BrClN3OS |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 5-[(3-bromothiophen-2-yl)methylamino]-2-butyl-4-chloropyridazin-3-one |
| SMILES | CCCCn1ncc(NCc2sccc2Br)c(Cl)c1=O |
| InChI | InChI=1S/C13H15BrClN3OS/c1-2-3-5-18-13(19)12(15)10(7-17-18)16-8-11-9(14)4-6-20-11/h4,6-7,16H,2-3,5,8H2,1H3 |
| InChIKey | VSMHURQPQGIUMZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |