C10H10ClN5O2 — CID 106403227
4-chloro-5-(1,2,4-oxadiazol-3-ylmethylamino)-2-prop-2-enylpyridazin-3-one (PubChem CID 106403227) has the molecular formula C10H10ClN5O2 and a molecular weight of 267.68 g/mol. Its IUPAC name is 4-chloro-5-(1,2,4-oxadiazol-3-ylmethylamino)-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-chloro-5-(1,2,4-oxadiazol-3-ylmethylamino)-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 106403227 |
| Molecular Formula | C10H10ClN5O2 |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-chloro-5-(1,2,4-oxadiazol-3-ylmethylamino)-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCc2ncon2)c(Cl)c1=O |
| InChI | InChI=1S/C10H10ClN5O2/c1-2-3-16-10(17)9(11)7(4-14-16)12-5-8-13-6-18-15-8/h2,4,6,12H,1,3,5H2 |
| InChIKey | DVAGSWKSDBMDPV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|