C12H9Br2N3OS — CID 114440356
4-bromo-5-[(3-bromothiophen-2-yl)methylamino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 114440356) has the molecular formula C12H9Br2N3OS and a molecular weight of 403.10 g/mol. Its IUPAC name is 4-bromo-5-[(3-bromothiophen-2-yl)methylamino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(3-bromothiophen-2-yl)methylamino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114440356 |
| Molecular Formula | C12H9Br2N3OS |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 4-bromo-5-[(3-bromothiophen-2-yl)methylamino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(NCc2sccc2Br)c(Br)c1=O |
| InChI | InChI=1S/C12H9Br2N3OS/c1-2-4-17-12(18)11(14)9(6-16-17)15-7-10-8(13)3-5-19-10/h1,3,5-6,15H,4,7H2 |
| InChIKey | IDTCZIIKSCSEOB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|