C10H9BrClN3O — CID 114441934
4-bromo-5-(2-chloroprop-2-enylamino)-2-prop-2-ynylpyridazin-3-one (PubChem CID 114441934) has the molecular formula C10H9BrClN3O and a molecular weight of 302.56 g/mol. Its IUPAC name is 4-bromo-5-(2-chloroprop-2-enylamino)-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 4-bromo-5-(2-chloroprop-2-enylamino)-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114441934 |
| Molecular Formula | C10H9BrClN3O |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 4-bromo-5-(2-chloroprop-2-enylamino)-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(NCC(=C)Cl)c(Br)c1=O |
| InChI | InChI=1S/C10H9BrClN3O/c1-3-4-15-10(16)9(11)8(6-14-15)13-5-7(2)12/h1,6,13H,2,4-5H2 |
| InChIKey | RWJPRFDADNMQQK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|