C12H11BrN4OS — CID 114435048
4-bromo-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 114435048) has the molecular formula C12H11BrN4OS and a molecular weight of 339.22 g/mol. Its IUPAC name is 4-bromo-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114435048 |
| Molecular Formula | C12H11BrN4OS |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 4-bromo-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(NCc2csc(C)n2)c(Br)c1=O |
| InChI | InChI=1S/C12H11BrN4OS/c1-3-4-17-12(18)11(13)10(6-15-17)14-5-9-7-19-8(2)16-9/h1,6-7,14H,4-5H2,2H3 |
| InChIKey | DQBASNBHHIHWGA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|