C12H18Cl2N2 — CID 107156107
3-chloro-N-(2-chloro-4,4-dimethylpentyl)pyridin-4-amine (PubChem CID 107156107) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-4,4-dimethylpentyl)pyridin-4-amine.
| Compound Name | 3-chloro-N-(2-chloro-4,4-dimethylpentyl)pyridin-4-amine |
|---|---|
| PubChem CID | 107156107 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-chloro-N-(2-chloro-4,4-dimethylpentyl)pyridin-4-amine |
| SMILES | CC(C)(C)CC(Cl)CNc1ccncc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-12(2,3)6-9(13)7-16-11-4-5-15-8-10(11)14/h4-5,8-9H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | HGAPIEHTUPSNFZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|