C13H13ClN2O — CID 79839104
2-[(3-chloro-4-pyridinyl)amino]-1-phenylethanol (PubChem CID 79839104) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-[(3-chloro-4-pyridinyl)amino]-1-phenylethanol.
| Compound Name | 2-[(3-chloro-4-pyridinyl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 79839104 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-[(3-chloro-4-pyridinyl)amino]-1-phenylethanol |
| SMILES | OC(CNc1ccncc1Cl)c1ccccc1 |
| InChI | InChI=1S/C13H13ClN2O/c14-11-8-15-7-6-12(11)16-9-13(17)10-4-2-1-3-5-10/h1-8,13,17H,9H2,(H,15,16) |
| InChIKey | RFINIMFVELXOLZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |