C15H17ClN2O3 — CID 97221871
(1R)-2-[(3-chloro-4-pyridinyl)amino]-1-(3,4-dimethoxyphenyl)ethanol (PubChem CID 97221871) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is (1R)-2-[(3-chloro-4-pyridinyl)amino]-1-(3,4-dimethoxyphenyl)ethanol.
| Compound Name | (1R)-2-[(3-chloro-4-pyridinyl)amino]-1-(3,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 97221871 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (1R)-2-[(3-chloro-4-pyridinyl)amino]-1-(3,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc([C@@H](O)CNc2ccncc2Cl)cc1OC |
| InChI | InChI=1S/C15H17ClN2O3/c1-20-14-4-3-10(7-15(14)21-2)13(19)9-18-12-5-6-17-8-11(12)16/h3-8,13,19H,9H2,1-2H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | OGQVLVUAMJWRGX-ZDUSSCGKSA-N |
| XLogP | 2.90 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |