C15H17ClN2O2 — CID 83165925
4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-3-amine (PubChem CID 83165925) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-3-amine.
| Compound Name | 4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 83165925 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-3-amine |
| SMILES | COc1ccc(C(C)Nc2cnccc2Cl)cc1OC |
| InChI | InChI=1S/C15H17ClN2O2/c1-10(18-13-9-17-7-6-12(13)16)11-4-5-14(19-2)15(8-11)20-3/h4-10,18H,1-3H3 |
| InChIKey | QVYURORUFMLYIP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |