C15H16BrClN2O2 — CID 103580081
5-bromo-3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-2-amine (PubChem CID 103580081) has the molecular formula C15H16BrClN2O2 and a molecular weight of 371.66 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 103580081 |
| Molecular Formula | C15H16BrClN2O2 |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 5-bromo-3-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]pyridin-2-amine |
| SMILES | COc1ccc(C(C)Nc2ncc(Br)cc2Cl)cc1OC |
| InChI | InChI=1S/C15H16BrClN2O2/c1-9(19-15-12(17)7-11(16)8-18-15)10-4-5-13(20-2)14(6-10)21-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | OJXXCJNNNWBJNA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |