C9H8BrClN2 — CID 103582656
5-bromo-N-but-3-yn-2-yl-3-chloropyridin-2-amine (PubChem CID 103582656) has the molecular formula C9H8BrClN2 and a molecular weight of 259.53 g/mol. Its IUPAC name is 5-bromo-N-but-3-yn-2-yl-3-chloropyridin-2-amine.
| Compound Name | 5-bromo-N-but-3-yn-2-yl-3-chloropyridin-2-amine |
|---|---|
| PubChem CID | 103582656 |
| Molecular Formula | C9H8BrClN2 |
| Molecular Weight | 259.53 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | 5-bromo-N-but-3-yn-2-yl-3-chloropyridin-2-amine |
| SMILES | C#CC(C)Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C9H8BrClN2/c1-3-6(2)13-9-8(11)4-7(10)5-12-9/h1,4-6H,2H3,(H,12,13) |
| InChIKey | XHGURVRRNBXQIY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|