C10H8ClF3N2 — CID 114382946
N-but-3-yn-2-yl-3-chloro-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 114382946) has the molecular formula C10H8ClF3N2 and a molecular weight of 248.64 g/mol. Its IUPAC name is N-but-3-yn-2-yl-3-chloro-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-but-3-yn-2-yl-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114382946 |
| Molecular Formula | C10H8ClF3N2 |
| Molecular Weight | 248.64 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | N-but-3-yn-2-yl-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | C#CC(C)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H8ClF3N2/c1-3-6(2)16-9-8(11)4-7(5-15-9)10(12,13)14/h1,4-6H,2H3,(H,15,16) |
| InChIKey | BKEKVWYABDQFMH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|