C13H18ClF3N2 — CID 63838693
3-chloro-N-(3-ethylpentan-2-yl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 63838693) has the molecular formula C13H18ClF3N2 and a molecular weight of 294.75 g/mol. Its IUPAC name is 3-chloro-N-(3-ethylpentan-2-yl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(3-ethylpentan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63838693 |
| Molecular Formula | C13H18ClF3N2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-chloro-N-(3-ethylpentan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCC(CC)C(C)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H18ClF3N2/c1-4-9(5-2)8(3)19-12-11(14)6-10(7-18-12)13(15,16)17/h6-9H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | QDTFTKGZOYRPBK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |