C13H14ClF3N2 — CID 60712371
3-chloro-N-(dicyclopropylmethyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 60712371) has the molecular formula C13H14ClF3N2 and a molecular weight of 290.72 g/mol. Its IUPAC name is 3-chloro-N-(dicyclopropylmethyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(dicyclopropylmethyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 60712371 |
| Molecular Formula | C13H14ClF3N2 |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-chloro-N-(dicyclopropylmethyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(NC(C2CC2)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H14ClF3N2/c14-10-5-9(13(15,16)17)6-18-12(10)19-11(7-1-2-7)8-3-4-8/h5-8,11H,1-4H2,(H,18,19) |
| InChIKey | ZLYMCHZXHJGUCZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |